16F16
Modify Date: 2025-09-23 16:09:04
16F16 structure
|
Common Name | 16F16 | ||
|---|---|---|---|---|
| CAS Number | 922507-80-0 | Molecular Weight | 320.77100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H17ClN2O3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
Use of 16F16A small molecule protein disulfide isomerase (PDI) inhibitor that suppress apoptosis induced by misfolded proteins. |
| Name | methyl 2-(2-chloroacetyl)-1-methyl-4,9-dihydro-3H-pyrido[3,4-b]indole-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H17ClN2O3 |
|---|---|
| Molecular Weight | 320.77100 |
| Exact Mass | 320.09300 |
| PSA | 62.40000 |
| LogP | 2.11750 |
| InChIKey | BCSIRYFYAKLJDK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(C)c2[nH]c3ccccc3c2CCN1C(=O)CCl |
| Storage condition | 2-8°C |
| RIDADR | NONH for all modes of transport |
|---|
| 16F16 |
| PDI inhibitor 16F16 |