Ethanone, 1-(9H-carbazol-2-yl)-2-chloro- structure
|
Common Name | Ethanone, 1-(9H-carbazol-2-yl)-2-chloro- | ||
|---|---|---|---|---|
| CAS Number | 92161-43-8 | Molecular Weight | 243.68800 | |
| Density | 1.362g/cm3 | Boiling Point | 463.1ºC at 760mmHg | |
| Molecular Formula | C14H10ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233.9ºC | |
| Name | 1-(9H-carbazol-2-yl)-2-chloroethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.362g/cm3 |
|---|---|
| Boiling Point | 463.1ºC at 760mmHg |
| Molecular Formula | C14H10ClNO |
| Molecular Weight | 243.68800 |
| Flash Point | 233.9ºC |
| Exact Mass | 243.04500 |
| PSA | 32.86000 |
| LogP | 3.74260 |
| Index of Refraction | 1.727 |
| InChIKey | SOUHCEGXVJNVJN-UHFFFAOYSA-N |
| SMILES | O=C(CCl)c1ccc2c(c1)[nH]c1ccccc12 |
|
~%
Ethanone, 1-(9H... CAS#:92161-43-8 |
| Literature: Ruberg; Small Journal of the American Chemical Society, 1941 , vol. 63, p. 736,739 |
|
~%
Ethanone, 1-(9H... CAS#:92161-43-8 |
| Literature: Ruberg; Small Journal of the American Chemical Society, 1941 , vol. 63, p. 736,739 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 1-carbazol-2-yl-2-chloro-ethanone |
| 2-Chloracetyl-carbazol |
| 1-Carbazol-2-yl-2-chlor-aethanon |
| 1-(9H-carbazol-2-yl)-2-chloro-1-ethanone |