5-methyl-5-(2-phenylmethoxyethyl)imidazolidine-2,4-dione structure
|
Common Name | 5-methyl-5-(2-phenylmethoxyethyl)imidazolidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 92108-69-5 | Molecular Weight | 248.27800 | |
| Density | 1.163g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-methyl-5-(2-phenylmethoxyethyl)imidazolidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.163g/cm3 |
|---|---|
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.27800 |
| Exact Mass | 248.11600 |
| PSA | 67.43000 |
| LogP | 1.84900 |
| InChIKey | HTCZFYMCCQZEIX-UHFFFAOYSA-N |
| SMILES | CC1(CCOCc2ccccc2)NC(=O)NC1=O |
|
~%
5-methyl-5-(2-p... CAS#:92108-69-5 |
| Literature: McConathy, J.; Martarello, L.; Goodman, M. M. Journal of Labelled Compounds and Radiopharmaceuticals, 2001 , vol. 44, p. S376 - S378 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-<2-Benzyloxy-ethyl>-2-methyl-5-methyl-hydantoin |
| 5-(3-oxo-3-phenyl-propenyl)-furan-2-carbaldehyde |
| 5-[3-Oxo-3-phenylprop-1-enyl]-2-furaldehyde |
| 5-<2-Benzoyl-vinyl>-2-formyl-furan |
| ETHYL 4-[(QUINOXALIN-2-YLCARBONYL)AMINO]BENZOATE |
| oxophenylpropenylfuraldehyde |
| 5-(2-benzyloxy-ethyl)-5-methyl-imidazolidine-2,4-dione |
| DL-5-Methyl-5-<2-benzyloxy-ethyl>-hydantoin |