2-[3-(dimethylamino)propyl]-6-nitrobenzo[de]isoquinoline-1,3-dione structure
|
Common Name | 2-[3-(dimethylamino)propyl]-6-nitrobenzo[de]isoquinoline-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 92078-85-8 | Molecular Weight | 327.33500 | |
| Density | 1.347g/cm3 | Boiling Point | 515.8ºC at 760 mmHg | |
| Molecular Formula | C17H17N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 265.7ºC | |
| Name | 2-[3-(dimethylamino)propyl]-6-nitrobenzo[de]isoquinoline-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.347g/cm3 |
|---|---|
| Boiling Point | 515.8ºC at 760 mmHg |
| Molecular Formula | C17H17N3O4 |
| Molecular Weight | 327.33500 |
| Flash Point | 265.7ºC |
| Exact Mass | 327.12200 |
| PSA | 88.13000 |
| LogP | 2.33580 |
| Index of Refraction | 1.653 |
| InChIKey | HXUICTWMWMKWSJ-UHFFFAOYSA-N |
| SMILES | CN(C)CCCN1C(=O)c2cccc3c([N+](=O)[O-])ccc(c23)C1=O |
|
~%
2-[3-(dimethyla... CAS#:92078-85-8 |
| Literature: Stevenson; Yen; Yang; Boykin; Wilson Journal of Medicinal Chemistry, 1984 , vol. 27, # 12 p. 1677 - 1682 |
| hms2557a14 |