3,3,6-trimethyl-1-propan-2-yl-3a,4,5,6,7,7a-hexahydrobenzo[c]isoxazole structure
|
Common Name | 3,3,6-trimethyl-1-propan-2-yl-3a,4,5,6,7,7a-hexahydrobenzo[c]isoxazole | ||
|---|---|---|---|---|
| CAS Number | 92030-73-4 | Molecular Weight | 211.34400 | |
| Density | 0.905g/cm3 | Boiling Point | 250.5ºC at 760 mmHg | |
| Molecular Formula | C13H25NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 63.5ºC | |
| Name | 3,3,6-trimethyl-1-propan-2-yl-3a,4,5,6,7,7a-hexahydro-2,1-benzoxazole |
|---|
| Density | 0.905g/cm3 |
|---|---|
| Boiling Point | 250.5ºC at 760 mmHg |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.34400 |
| Flash Point | 63.5ºC |
| Exact Mass | 211.19400 |
| PSA | 12.47000 |
| LogP | 3.16330 |
| Index of Refraction | 1.455 |
| InChIKey | NANSZPPPRQQTJB-UHFFFAOYSA-N |
| SMILES | CC1CCC2C(C1)N(C(C)C)OC2(C)C |
|
~%
3,3,6-trimethyl... CAS#:92030-73-4 |
| Literature: LeBel,N.A. et al. Journal of the American Chemical Society, 1964 , vol. 86, p. 3759 - 3767 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |