3-[(2-chloro-6-fluorophenyl)methyl]-2-methyl-1H-pyridin-4-one
Modify Date: 2024-01-14 19:18:11
![3-[(2-chloro-6-fluorophenyl)methyl]-2-methyl-1H-pyridin-4-one Structure](https://image.chemsrc.com/caspic/105/919366-52-2.png)
3-[(2-chloro-6-fluorophenyl)methyl]-2-methyl-1H-pyridin-4-one structure
|
Common Name | 3-[(2-chloro-6-fluorophenyl)methyl]-2-methyl-1H-pyridin-4-one | ||
|---|---|---|---|---|
| CAS Number | 919366-52-2 | Molecular Weight | 251.68400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H11ClFNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-[(2-chloro-6-fluorophenyl)methyl]-2-methyl-1H-pyridin-4-one |
|---|
| Molecular Formula | C13H11ClFNO |
|---|---|
| Molecular Weight | 251.68400 |
| Exact Mass | 251.05100 |
| PSA | 32.86000 |
| LogP | 3.06660 |
| InChIKey | GSQSUZPBRNQWAT-UHFFFAOYSA-N |
| SMILES | Cc1[nH]ccc(=O)c1Cc1c(F)cccc1Cl |
|
~%
3-[(2-chloro-6-... CAS#:919366-52-2 |
| Literature: Kitagawa, Hideo; Kumura, Ko; Takahata, Sho; Iida, Maiko; Atsumi, Kunio Bioorganic and Medicinal Chemistry, 2007 , vol. 15, # 2 p. 1106 - 1116 |
|
~%
3-[(2-chloro-6-... CAS#:919366-52-2 |
| Literature: Kitagawa, Hideo; Kumura, Ko; Takahata, Sho; Iida, Maiko; Atsumi, Kunio Bioorganic and Medicinal Chemistry, 2007 , vol. 15, # 2 p. 1106 - 1116 |
