(S)-(+)-2,2'-Bis[di(3,5-di-i-propyl-4-dimethylaminophenyl)phosphino]-6,6'-dimethoxy-1,1'-biphenyl,min. structure
|
Common Name | (S)-(+)-2,2'-Bis[di(3,5-di-i-propyl-4-dimethylaminophenyl)phosphino]-6,6'-dimethoxy-1,1'-biphenyl,min. | ||
|---|---|---|---|---|
| CAS Number | 919338-66-2 | Molecular Weight | 1091.52000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C70H100N4O2P2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Name | 4,4',4'',4'''-[(6,6'-Dimethoxy-2,2'-biphenyldiyl)diphosphinetriyl ]tetrakis(2,6-diisopropyl-N,N-dimethylaniline) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C70H100N4O2P2 |
|---|---|
| Molecular Weight | 1091.52000 |
| Exact Mass | 1090.73000 |
| PSA | 58.60000 |
| LogP | 16.13840 |
| Appearance of Characters | Powder | white |
| InChIKey | SBQGDYGNDIQAIT-UHFFFAOYSA-N |
| SMILES | COc1cccc(P(c2cc(C(C)C)c(N(C)C)c(C(C)C)c2)c2cc(C(C)C)c(N(C)C)c(C(C)C)c2)c1-c1c(OC)cccc1P(c1cc(C(C)C)c(N(C)C)c(C(C)C)c1)c1cc(C(C)C)c(N(C)C)c(C(C)C)c1 |
| Storage condition | 2-8°C |
| Stability | store cold |
| RIDADR | NONH for all modes of transport |
|---|
| MFCD09753010 |