4-methoxy-1-nitro-2-phenylbenzene structure
|
Common Name | 4-methoxy-1-nitro-2-phenylbenzene | ||
|---|---|---|---|---|
| CAS Number | 91901-16-5 | Molecular Weight | 229.23100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-methoxy-1-nitro-2-phenylbenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H11NO3 |
|---|---|
| Molecular Weight | 229.23100 |
| Exact Mass | 229.07400 |
| PSA | 55.05000 |
| LogP | 3.79360 |
| InChIKey | XNIXNFJHWHWYFG-UHFFFAOYSA-N |
| SMILES | COc1ccc([N+](=O)[O-])c(-c2ccccc2)c1 |
|
~10%
4-methoxy-1-nit... CAS#:91901-16-5 |
| Literature: Nielsen; Peters; Axelsson Synthetic Communications, 2000 , vol. 30, # 19 p. 3501 - 3509 |
|
~%
4-methoxy-1-nit... CAS#:91901-16-5 |
| Literature: Smith,P.A.S.; Hall,J.H. Journal of the American Chemical Society, 1962 , vol. 84, p. 480 - 485 |
|
~%
4-methoxy-1-nit... CAS#:91901-16-5 |
| Literature: Kauffman; Litak; Boyko Journal of Heterocyclic Chemistry, 1995 , vol. 32, # 5 p. 1541 - 1555 |
| 5-methoxy-2-nitrobiphenyl |
| 4-nitro-3-phenylanisole |
| 2-Nitro-5-methoxybiphenyl |
| 1,1'-Biphenyl,5-methoxy-2-nitro |