3-[dimethyl(phenyl)silyl]-1-phenylpent-1-yn-3-ol structure
|
Common Name | 3-[dimethyl(phenyl)silyl]-1-phenylpent-1-yn-3-ol | ||
|---|---|---|---|---|
| CAS Number | 918138-93-9 | Molecular Weight | 294.46300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H22OSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-[dimethyl(phenyl)silyl]-1-phenylpent-1-yn-3-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H22OSi |
|---|---|
| Molecular Weight | 294.46300 |
| Exact Mass | 294.14400 |
| PSA | 20.23000 |
| LogP | 3.75390 |
| InChIKey | TZILYYOKNRGIMS-UHFFFAOYSA-N |
| SMILES | CCC(O)(C#Cc1ccccc1)[Si](C)(C)c1ccccc1 |
|
~55%
3-[dimethyl(phe... CAS#:918138-93-9 |
| Literature: Reynolds, Troy E.; Bharadwaj, Ashwin R.; Scheidt, Karl A. Journal of the American Chemical Society, 2006 , vol. 128, # 48 p. 15382 - 15383 |
| 1-Pentyn-3-ol,3-(dimethylphenylsilyl)-1-phenyl |
| 3-(dimethyl(phenyl)silyl)-1-phenylpent-1-yn-3-ol |