(4-BROMO-PHENYL)-(4-TRIFLUOROMETHOXY-PHENYL)-METHANONE structure
|
Common Name | (4-BROMO-PHENYL)-(4-TRIFLUOROMETHOXY-PHENYL)-METHANONE | ||
|---|---|---|---|---|
| CAS Number | 917925-71-4 | Molecular Weight | 330.174 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 465.1±40.0 °C at 760 mmHg | |
| Molecular Formula | C13H16BrNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.1±27.3 °C | |
| Name | 2-(4-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 465.1±40.0 °C at 760 mmHg |
| Molecular Formula | C13H16BrNO4 |
| Molecular Weight | 330.174 |
| Flash Point | 235.1±27.3 °C |
| Exact Mass | 329.026276 |
| PSA | 75.63000 |
| LogP | 3.52 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.556 |
| InChIKey | HFPMULXPVQWEJG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C(=O)O)c1ccc(Br)cc1 |
| HS Code | 2924299090 |
|---|
|
~99%
(4-BROMO-PHENYL... CAS#:917925-71-4 |
| Literature: Niu, Huifeng Patent: US2008/207563 A1, 2008 ; Location in patent: Page/Page column 25 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-(Boc-amino)-2-(4-bromophenyl)aceticAcid |
| F2147-0614 |
| (4-Bromophenyl)({[(2-methyl-2-propanyl)oxy]carbonyl}amino)acetic acid |
| (4-Bromophenyl)-tert-butoxycarbonylaminoacetic acid |
| rac-(4-bromophenyl)-tert-butoxycarbonylaminoacetic acid |
| Benzeneacetic acid, 4-bromo-α-[[(1,1-dimethylethoxy)carbonyl]amino]- |