6-Oxo-6-(2,3,4-trimethoxyphenyl)hexanoic acid
Modify Date: 2025-08-25 21:06:17
6-Oxo-6-(2,3,4-trimethoxyphenyl)hexanoic acid structure
|
Common Name | 6-Oxo-6-(2,3,4-trimethoxyphenyl)hexanoic acid | ||
|---|---|---|---|---|
| CAS Number | 917591-97-0 | Molecular Weight | 296.31600 | |
| Density | 1.168g/cm3 | Boiling Point | 475.6ºC at 760 mmHg | |
| Molecular Formula | C15H20O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.6ºC | |
| Name | 6-Oxo-6-(2,3,4-trimethoxyphenyl)hexanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.168g/cm3 |
|---|---|
| Boiling Point | 475.6ºC at 760 mmHg |
| Molecular Formula | C15H20O6 |
| Molecular Weight | 296.31600 |
| Flash Point | 173.6ºC |
| Exact Mass | 296.12600 |
| PSA | 82.06000 |
| LogP | 2.54010 |
| Index of Refraction | 1.514 |
| InChIKey | AWWAWFSNSOMPDE-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)CCCCC(=O)O)c(OC)c1OC |
| HS Code | 2918990090 |
|---|
|
~79%
6-Oxo-6-(2,3,4-... CAS#:917591-97-0 |
| Literature: Pinney, Kevin G.; Sriram, Madhavi Patent: US2006/293394 A1, 2006 ; Location in patent: Page/Page column 31 ; |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:917591-98-1| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 6-Oxo-6-(2,3,4-trimethoxy-phenyl)-hexanoic acid |
| 6-(2,3,4-TRIMETHOXYPHENYL)-6-OXOHEXANOIC ACID |