4-(4-Chlorophenyl)piperidine-4-carbonitrile structure
|
Common Name | 4-(4-Chlorophenyl)piperidine-4-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 91721-16-3 | Molecular Weight | 220.698 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 370.1±42.0 °C at 760 mmHg | |
| Molecular Formula | C12H13ClN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.6±27.9 °C | |
| Name | 4-(4-chlorophenyl)piperidine-4-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 370.1±42.0 °C at 760 mmHg |
| Molecular Formula | C12H13ClN2 |
| Molecular Weight | 220.698 |
| Flash Point | 177.6±27.9 °C |
| Exact Mass | 220.076721 |
| PSA | 35.82000 |
| LogP | 2.07 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.580 |
| InChIKey | PZZPISYIGMLPJB-UHFFFAOYSA-N |
| SMILES | N#CC1(c2ccc(Cl)cc2)CCNCC1 |
| HS Code | 2933399090 |
|---|
|
~97%
4-(4-Chlorophen... CAS#:91721-16-3 |
| Literature: ASTEX THERAPEUTICS LIMITED; THE INSTITUTE OF CANCER RESEARCH: ROYAL CANCER HOSPITAL; ASTRAZENECA AB Patent: WO2006/136829 A2, 2006 ; Location in patent: Page/Page column 119-120 ; WO 2006/136829 A2 |
|
~%
4-(4-Chlorophen... CAS#:91721-16-3 |
| Literature: GLAXO GROUP LIMITED Patent: WO2004/5256 A2, 2004 ; Location in patent: Page 34 ; WO 2004/005256 A2 |
|
~%
4-(4-Chlorophen... CAS#:91721-16-3 |
| Literature: ChemoCentryx, Inc. Patent: US2007/88036 A1, 2007 ; Location in patent: Page/Page column 16 ; US 20070088036 A1 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Piperidinecarbonitrile, 4-(4-chlorophenyl)- |
| 4-(4-chlorophenyl)-4-cyanopiperidine |
| 4-(4-chloro-phenyl)-piperidine-4-carbonitrile |
| 4-Piperidinecarbonitrile,4-(4-chlorophenyl) |
| 4-(4-Chlorophenyl)-4-piperidinecarbonitrile |