tert-butyl 4-(3-(ethoxycarbonyl)-2-oxopropyl)piperidine-1-carboxylate
Modify Date: 2025-09-16 16:57:30
tert-butyl 4-(3-(ethoxycarbonyl)-2-oxopropyl)piperidine-1-carboxylate structure
|
Common Name | tert-butyl 4-(3-(ethoxycarbonyl)-2-oxopropyl)piperidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 916791-39-4 | Molecular Weight | 313.389 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 400.1±15.0 °C at 760 mmHg | |
| Molecular Formula | C16H27NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.8±20.4 °C | |
| Name | tert-butyl 4-(3-(ethoxycarbonyl)-2-oxopropyl)piperidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 400.1±15.0 °C at 760 mmHg |
| Molecular Formula | C16H27NO5 |
| Molecular Weight | 313.389 |
| Flash Point | 195.8±20.4 °C |
| Exact Mass | 313.188934 |
| PSA | 72.91000 |
| LogP | 2.32 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.473 |
| InChIKey | JDIFHIYGJWKGHP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)CC1CCN(C(=O)OC(C)(C)C)CC1 |
| HS Code | 2933399090 |
|---|
|
~%
tert-butyl 4-(3... CAS#:916791-39-4 |
| Literature: WO2007/3962 A2, ; Page/Page column 22 ; WO 2007/003962 A2 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Methyl-2-propanyl 4-(4-ethoxy-2,4-dioxobutyl)-1-piperidinecarboxylate |
| 4-Piperidinebutanoic acid, 1-[(1,1-dimethylethoxy)carbonyl]-β-oxo-, ethyl ester |
| 1-Boc-b-oxo-4-piperidinebutanoic acid ethyl ester |