7-nitro-9-oxo-fluorene-1-carboxylic acid structure
|
Common Name | 7-nitro-9-oxo-fluorene-1-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 91651-26-2 | Molecular Weight | 269.20900 | |
| Density | 1.591g/cm3 | Boiling Point | 546.4ºC at 760 mmHg | |
| Molecular Formula | C14H7NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.3ºC | |
| Name | 7-nitro-9-oxofluorene-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.591g/cm3 |
|---|---|
| Boiling Point | 546.4ºC at 760 mmHg |
| Molecular Formula | C14H7NO5 |
| Molecular Weight | 269.20900 |
| Flash Point | 235.3ºC |
| Exact Mass | 269.03200 |
| PSA | 100.19000 |
| LogP | 3.02760 |
| Index of Refraction | 1.728 |
| InChIKey | OPQIPTHMHAOFOW-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccc2c1C(=O)c1cc([N+](=O)[O-])ccc1-2 |
| HS Code | 2918300090 |
|---|
|
~25%
7-nitro-9-oxo-f... CAS#:91651-26-2 |
| Literature: CYTOVIA, INC.; KEMNITZER, William, E.; CAI, Sui Xiong; DREWE, John, A.; SIRISOMA, Nilantha, Sudath Patent: WO2006/39356 A2, 2006 ; Location in patent: Page/Page column 49-50 ; WO 2006/039356 A2 |
|
~%
7-nitro-9-oxo-f... CAS#:91651-26-2 |
| Literature: Weisburger; Weisburger Journal of Organic Chemistry, 1956 , vol. 21, p. 1386 |
|
~%
7-nitro-9-oxo-f... CAS#:91651-26-2 |
| Literature: Weisburger; Weisburger Journal of Organic Chemistry, 1956 , vol. 21, p. 1386 |
|
~%
7-nitro-9-oxo-f... CAS#:91651-26-2 |
| Literature: Campbell; Reid Journal of the Chemical Society, 1958 , p. 4743,4746 |
|
~%
7-nitro-9-oxo-f... CAS#:91651-26-2 |
| Literature: Fittig; Liepmann Justus Liebigs Annalen der Chemie, 1880 , vol. 200, p. 3 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 7-nitro-9-oxo-fluorene-1-carboxylic acid |
| 7-Nitro-9-fluorenon-1-carbonsaeure |
| 7-Nitro-9-oxo-9H-fluorene-1-carboxylic acid |
| 7-Nitro-9-oxofluoren-1-carbonsaeure |