N-[(E)-(3-nitrophenyl)methylideneamino]acridin-9-amine structure
|
Common Name | N-[(E)-(3-nitrophenyl)methylideneamino]acridin-9-amine | ||
|---|---|---|---|---|
| CAS Number | 91627-28-0 | Molecular Weight | 342.35100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H14N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[(E)-(3-nitrophenyl)methylideneamino]acridin-9-amine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H14N4O2 |
|---|---|
| Molecular Weight | 342.35100 |
| Exact Mass | 342.11200 |
| PSA | 86.33000 |
| LogP | 4.68730 |
| InChIKey | ULPDQWLPFYJLEG-FYJGNVAPSA-N |
| SMILES | O=[N+]([O-])c1cccc(C=NNc2c3ccccc3nc3ccccc23)c1 |
|
~%
N-[(E)-(3-nitro... CAS#:91627-28-0 |
| Literature: Patel; Parekh Journal of the Indian Chemical Society, 1988 , vol. 65, # 4 p. 282 - 284 |
| 3-Nitrobenzaldehyde 9-acridinylhydrazone |
| BENZALDEHYDE,3-NITRO-,9-ACRIDINYLHYDRAZONE |