1,3-bis[(1,3-dioxoisoindol-2-yl)methyl]urea structure
|
Common Name | 1,3-bis[(1,3-dioxoisoindol-2-yl)methyl]urea | ||
|---|---|---|---|---|
| CAS Number | 91626-88-9 | Molecular Weight | 378.33800 | |
| Density | 1.513g/cm3 | Boiling Point | 662.1ºC at 760 mmHg | |
| Molecular Formula | C19H14N4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 354.2ºC | |
| Name | 1,3-bis[(1,3-dioxoisoindol-2-yl)methyl]urea |
|---|
| Density | 1.513g/cm3 |
|---|---|
| Boiling Point | 662.1ºC at 760 mmHg |
| Molecular Formula | C19H14N4O5 |
| Molecular Weight | 378.33800 |
| Flash Point | 354.2ºC |
| Exact Mass | 378.09600 |
| PSA | 115.89000 |
| LogP | 1.45060 |
| Index of Refraction | 1.679 |
| InChIKey | HKCUJIRTCTVVHT-UHFFFAOYSA-N |
| SMILES | O=C(NCN1C(=O)c2ccccc2C1=O)NCN1C(=O)c2ccccc2C1=O |
|
~59%
1,3-bis[(1,3-di... CAS#:91626-88-9 |
| Literature: Aly, N. F.; Fahmy, A. F. M.; Mahmoud, M.; Arief, M. H.; Elkoumy, M. A. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1984 , vol. 23, # 2 p. 121 - 124 |
|
~%
1,3-bis[(1,3-di... CAS#:91626-88-9 |
| Literature: Boyer, Joseph H.; Manimaran, Thanikavelu; Wolford, Lionel T. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1988 , p. 2137 - 2140 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |