Benzenemethanamine, 4-chloro-3-(trifluoromethoxy)-
Modify Date: 2025-09-22 18:34:25
Benzenemethanamine, 4-chloro-3-(trifluoromethoxy)- structure
|
Common Name | Benzenemethanamine, 4-chloro-3-(trifluoromethoxy)- | ||
|---|---|---|---|---|
| CAS Number | 916210-69-0 | Molecular Weight | 225.59500 | |
| Density | 1.394±0.06 g/cm3(20 °C , 760mmHg) | Boiling Point | 223.7±35.0 °C (760 mmHg) | |
| Molecular Formula | C8H7ClF3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Benzenemethanamine, 4-chloro-3-(trifluoromethoxy)- |
|---|---|
| Synonym | More Synonyms |
| Density | 1.394±0.06 g/cm3(20 °C , 760mmHg) |
|---|---|
| Boiling Point | 223.7±35.0 °C (760 mmHg) |
| Molecular Formula | C8H7ClF3NO |
| Molecular Weight | 225.59500 |
| Exact Mass | 225.01700 |
| PSA | 35.25000 |
| LogP | 3.39760 |
| InChIKey | XZZFTTABTJCTSR-UHFFFAOYSA-N |
| SMILES | NCc1ccc(Cl)c(OC(F)(F)F)c1 |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| [4-Chloro-3-(trifluoromethoxy)phenyl]methanamine |
| 4-CHLORO-3-(TRIFLUOROMETHOXY)BENZYLAMINE |