1-(2-fluorophenyl)-2,2-dimethylcyclopropane-1-carboxylic acid
Modify Date: 2025-08-26 10:49:51
1-(2-fluorophenyl)-2,2-dimethylcyclopropane-1-carboxylic acid structure
|
Common Name | 1-(2-fluorophenyl)-2,2-dimethylcyclopropane-1-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 915923-90-9 | Molecular Weight | 208.22900 | |
| Density | 1.219g/cm3 | Boiling Point | 312ºC at 760 mmHg | |
| Molecular Formula | C12H13FO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 142.5ºC | |
| Name | 1-(2-fluorophenyl)-2,2-dimethylcyclopropane-1-carboxylic acid |
|---|
| Density | 1.219g/cm3 |
|---|---|
| Boiling Point | 312ºC at 760 mmHg |
| Molecular Formula | C12H13FO2 |
| Molecular Weight | 208.22900 |
| Flash Point | 142.5ºC |
| Exact Mass | 208.09000 |
| PSA | 37.30000 |
| LogP | 2.57800 |
| Index of Refraction | 1.54 |
| InChIKey | AISGDNPYRXZDBS-UHFFFAOYSA-N |
| SMILES | CC1(C)CC1(C(=O)O)c1ccccc1F |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |