2-(3-methoxyphenyl)-1,3-thiazole-5-carbaldehyde structure
|
Common Name | 2-(3-methoxyphenyl)-1,3-thiazole-5-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 915923-79-4 | Molecular Weight | 219.26000 | |
| Density | 1.266g/cm3 | Boiling Point | 397.7ºC at 760 mmHg | |
| Molecular Formula | C11H9NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.3ºC | |
| Name | 2-(3-methoxyphenyl)-1,3-thiazole-5-carbaldehyde |
|---|
| Density | 1.266g/cm3 |
|---|---|
| Boiling Point | 397.7ºC at 760 mmHg |
| Molecular Formula | C11H9NO2S |
| Molecular Weight | 219.26000 |
| Flash Point | 194.3ºC |
| Exact Mass | 219.03500 |
| PSA | 67.43000 |
| LogP | 2.63120 |
| Index of Refraction | 1.619 |
| InChIKey | YVAFASMGYFSGPR-UHFFFAOYSA-N |
| SMILES | COc1cccc(-c2ncc(C=O)s2)c1 |
| HS Code | 2934100090 |
|---|
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |