3-amino-4-(3-methylpiperidin-1-yl)benzamide structure
|
Common Name | 3-amino-4-(3-methylpiperidin-1-yl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 915920-42-2 | Molecular Weight | 233.30900 | |
| Density | 1.151g/cm3 | Boiling Point | 412.7ºC at 760 mmHg | |
| Molecular Formula | C13H19N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.4ºC | |
| Name | 3-amino-4-(3-methylpiperidin-1-yl)benzamide |
|---|
| Density | 1.151g/cm3 |
|---|---|
| Boiling Point | 412.7ºC at 760 mmHg |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.30900 |
| Flash Point | 203.4ºC |
| Exact Mass | 233.15300 |
| PSA | 72.35000 |
| LogP | 2.95050 |
| Index of Refraction | 1.595 |
| InChIKey | RCECLIJCWZSIRW-UHFFFAOYSA-N |
| SMILES | CC1CCCN(c2ccc(C(N)=O)cc2N)C1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |