4-Isoxazolecarboxylicacid,3-ethyl-5-phenyl-(7CI)
Modify Date: 2025-09-26 10:22:06
4-Isoxazolecarboxylicacid,3-ethyl-5-phenyl-(7CI) structure
|
Common Name | 4-Isoxazolecarboxylicacid,3-ethyl-5-phenyl-(7CI) | ||
|---|---|---|---|---|
| CAS Number | 91569-54-9 | Molecular Weight | 217.22100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-ethyl-5-phenyl-1,2-oxazole-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H11NO3 |
|---|---|
| Molecular Weight | 217.22100 |
| Exact Mass | 217.07400 |
| PSA | 63.33000 |
| LogP | 2.60220 |
| InChIKey | PRYKGZVEXSTAGZ-UHFFFAOYSA-N |
| SMILES | CCc1noc(-c2ccccc2)c1C(=O)O |
|
~%
4-Isoxazolecarb... CAS#:91569-54-9 |
| Literature: Doyle,F.P. et al. Journal of the Chemical Society, 1963 , p. 5838 - 5845 |
| 3-Aethyl-4-carboxy-5-phenyl-isoxazol |
| 3-ethyl-5-phenyl-isoxazole-4-carboxylic acid |
| 4-Isoxazolecarboxylicacid,3-ethyl-5-phenyl |