4,8-dichloro-6-nitroquinoline-3-carbonitrile
Modify Date: 2025-11-30 09:45:05
4,8-dichloro-6-nitroquinoline-3-carbonitrile structure
|
Common Name | 4,8-dichloro-6-nitroquinoline-3-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 915369-46-9 | Molecular Weight | 268.05600 | |
| Density | 1.66g/cm3 | Boiling Point | 456.1ºC at 760 mmHg | |
| Molecular Formula | C10H3Cl2N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.6ºC | |
| Name | 4,8-dichloro-6-nitroquinoline-3-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.66g/cm3 |
|---|---|
| Boiling Point | 456.1ºC at 760 mmHg |
| Molecular Formula | C10H3Cl2N3O2 |
| Molecular Weight | 268.05600 |
| Flash Point | 229.6ºC |
| Exact Mass | 266.96000 |
| PSA | 82.50000 |
| LogP | 3.84468 |
| Index of Refraction | 1.701 |
| InChIKey | MPJQECCTXQJBOS-UHFFFAOYSA-N |
| SMILES | N#Cc1cnc2c(Cl)cc([N+](=O)[O-])cc2c1Cl |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,8-Dichloro-6-nitro-quinoline-3-carbonitrile |