Pyrrolo[2,1-a]isoquinoline-1,2-dimethanol, 5,6-dihydro-3-methyl-, bis (methylcarbamate) (ester) structure
|
Common Name | Pyrrolo[2,1-a]isoquinoline-1,2-dimethanol, 5,6-dihydro-3-methyl-, bis (methylcarbamate) (ester) | ||
|---|---|---|---|---|
| CAS Number | 91523-58-9 | Molecular Weight | 357.40400 | |
| Density | 1.28g/cm3 | Boiling Point | 611ºC at 760 mmHg | |
| Molecular Formula | C19H23N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 323.3ºC | |
| Name | [3-methyl-1-(methylcarbamoyloxymethyl)-5,6-dihydropyrrolo[2,1-a]isoquinolin-2-yl]methyl N-methylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 611ºC at 760 mmHg |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.40400 |
| Flash Point | 323.3ºC |
| Exact Mass | 357.16900 |
| PSA | 81.59000 |
| LogP | 3.51340 |
| Index of Refraction | 1.61 |
| InChIKey | HPJVPLQUPOPLBQ-UHFFFAOYSA-N |
| SMILES | CNC(=O)OCc1c(COC(=O)NC)c2n(c1C)CCc1ccccc1-2 |
|
~%
Pyrrolo[2,1-a]i... CAS#:91523-58-9 |
| Literature: Anderson, Wayne K.; McPherson, Howard L.; New, James S.; Rick, Arvela C. Journal of Medicinal Chemistry, 1984 , vol. 27, # 10 p. 1321 - 1325 |
|
~32%
Pyrrolo[2,1-a]i... CAS#:91523-58-9 |
| Literature: Anderson, Wayne K.; McPherson, Howard L.; New, James S.; Rick, Arvela C. Journal of Medicinal Chemistry, 1984 , vol. 27, # 10 p. 1321 - 1325 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,2-bis(hydroxymethyl)-5,6-dihydro-3-methylpyrrolo[2,1-a]isoquinoline bis(methylcarbamate) |
| Pyrrolo[2,2-dimethanol,5,6-dihydro-3-methyl-,bis(methylcarbamate) (ester) |