2-(4-((6-BROMO-3-NITROQUINOLIN-4-YL)AMINO)PHENYL)-2-METHYLPROPANENITRILE structure
|
Common Name | 2-(4-((6-BROMO-3-NITROQUINOLIN-4-YL)AMINO)PHENYL)-2-METHYLPROPANENITRILE | ||
|---|---|---|---|---|
| CAS Number | 915019-51-1 | Molecular Weight | 411.25200 | |
| Density | 1.518g/cm3 | Boiling Point | 540.6ºC at 760 mmHg | |
| Molecular Formula | C19H15BrN4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 280.7ºC | |
| Name | 2-[4-[(6-bromo-3-nitroquinolin-4-yl)amino]phenyl]-2-methylpropanenitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.518g/cm3 |
|---|---|
| Boiling Point | 540.6ºC at 760 mmHg |
| Molecular Formula | C19H15BrN4O2 |
| Molecular Weight | 411.25200 |
| Flash Point | 280.7ºC |
| Exact Mass | 410.03800 |
| PSA | 94.53000 |
| LogP | 6.04648 |
| Index of Refraction | 1.694 |
| InChIKey | BFZRWFNXSNWGCF-UHFFFAOYSA-N |
| SMILES | CC(C)(C#N)c1ccc(Nc2c([N+](=O)[O-])cnc3ccc(Br)cc23)cc1 |
| HS Code | 2933499090 |
|---|
|
~87%
2-(4-((6-BROMO-... CAS#:915019-51-1 |
| Literature: PROGENICS PHARMACEUTICALS, INC. Patent: WO2009/155527 A2, 2009 ; Location in patent: Page/Page column 264 ; WO 2009/155527 A2 |
|
~%
2-(4-((6-BROMO-... CAS#:915019-51-1 |
| Literature: WO2011/1212 A1, ; WO 2011/001212 A1 |
|
~%
2-(4-((6-BROMO-... CAS#:915019-51-1 |
| Literature: WO2011/1212 A1, ; WO 2011/001212 A1 US2012/108627 A1, ; |
|
~%
2-(4-((6-BROMO-... CAS#:915019-51-1 |
| Literature: WO2011/1212 A1, ; WO 2011/001212 A1 |
|
~%
2-(4-((6-BROMO-... CAS#:915019-51-1 |
| Literature: WO2012/116237 A2, ; WO 2012/116237 A2 |
|
~%
2-(4-((6-BROMO-... CAS#:915019-51-1 |
| Literature: US2012/108627 A1, ; |
|
~%
2-(4-((6-BROMO-... CAS#:915019-51-1 |
| Literature: WO2012/116237 A2, ; WO 2012/116237 A2 |
| Precursor 8 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-[4-(6-bromo-3-nitroquinolin-4-ylamino)phenyl]-2-methylpropionitrile |
| 2-(4-(6-bromo-3-nitroquinolin-4-ylamino)phenyl)-2-methyl propanenitrile |