Amlodipine orotate
Amlodipine orotate structure
|
Common Name | Amlodipine orotate | ||
|---|---|---|---|---|
| CAS Number | 914941-70-1 | Molecular Weight | 564.98 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H29ClN4O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Amlodipine orotateAmlodipine orotate is a medication used to lower blood pressure and prevent chest pain. It belongs to a group of medications known as dihydropyridine-type calcium channel blockers. By widening of blood vessels it lowers blood pressure. In angina, amlodipine increases blood flow to the heart muscle to relieve pain due to angina. |
| Name | Amlodipine orotate |
|---|
| Description | Amlodipine orotate is a medication used to lower blood pressure and prevent chest pain. It belongs to a group of medications known as dihydropyridine-type calcium channel blockers. By widening of blood vessels it lowers blood pressure. In angina, amlodipine increases blood flow to the heart muscle to relieve pain due to angina. |
|---|
| Molecular Formula | C25H29ClN4O9 |
|---|---|
| Molecular Weight | 564.98 |
| InChIKey | DBGOBQCYSPDGNR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(COCCN)NC(C)=C(C(=O)OC)C1c1ccccc1Cl.O=C(O)c1cc(=O)[nH]c(=O)[nH]1 |