2-(2,4-dichloro-5-fluorophenyl)piperazine structure
|
Common Name | 2-(2,4-dichloro-5-fluorophenyl)piperazine | ||
|---|---|---|---|---|
| CAS Number | 914348-92-8 | Molecular Weight | 249.11200 | |
| Density | 1.305g/cm3 | Boiling Point | 326.9ºC at 760 mmHg | |
| Molecular Formula | C10H11Cl2FN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 151.5ºC | |
| Name | 2-(2,4-dichloro-5-fluorophenyl)piperazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.305g/cm3 |
|---|---|
| Boiling Point | 326.9ºC at 760 mmHg |
| Molecular Formula | C10H11Cl2FN2 |
| Molecular Weight | 249.11200 |
| Flash Point | 151.5ºC |
| Exact Mass | 248.02800 |
| PSA | 24.06000 |
| LogP | 3.02400 |
| Index of Refraction | 1.534 |
| InChIKey | UXYATDLPBMRWFA-UHFFFAOYSA-N |
| SMILES | Fc1cc(C2CNCCN2)c(Cl)cc1Cl |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,6-dihydroxy-4-methylpyridine |