3-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]pentanedioic Acid Diethyl Ester structure
|
Common Name | 3-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]pentanedioic Acid Diethyl Ester | ||
|---|---|---|---|---|
| CAS Number | 91424-39-4 | Molecular Weight | 318.48100 | |
| Density | 0.978g/cm3 | Boiling Point | 315.086ºC at 760 mmHg | |
| Molecular Formula | C15H30O5Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 120.002ºC | |
| Name | diethyl 3-[tert-butyl(dimethyl)silyl]oxypentanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.978g/cm3 |
|---|---|
| Boiling Point | 315.086ºC at 760 mmHg |
| Molecular Formula | C15H30O5Si |
| Molecular Weight | 318.48100 |
| Flash Point | 120.002ºC |
| Exact Mass | 318.18600 |
| PSA | 61.83000 |
| LogP | 3.28320 |
| Index of Refraction | 1.438 |
| InChIKey | PPZUZFQSSULNGN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(CC(=O)OCC)O[Si](C)(C)C(C)(C)C |
|
~96%
3-[[(1,1-Dimeth... CAS#:91424-39-4 |
| Literature: Ivsic, Trpimir; Dokli, Irena; Rimac, Ana; Hamersak, Zdenko European Journal of Organic Chemistry, 2014 , vol. 2014, # 3 p. 631 - 638 |
|
~%
3-[[(1,1-Dimeth... CAS#:91424-39-4 |
| Literature: US5049577 A1, ; US 5049577 A |
|
~%
3-[[(1,1-Dimeth... CAS#:91424-39-4 |
| Literature: Journal of the American Chemical Society, , vol. 108, # 8 p. 1969 - 1979 |
| 3-[(tert-Butyldimethylsilyl)oxy]pentanedioic Acid Diethyl Ester |
| diethyl 3-<(tert-butyldimethylsilyl)oxy>pentanedioate |
| 3-(t-Butyldimethylsilyloxy)glutaric acid,diethyl ester |
| 3-(dimethyl-tert-butyl-silyloxy)-pentanedioic acid diethyl ester |
| Pentanedioic acid,3-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-,diethyl ester |
| 3-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]pentanedioic Acid Diethyl Ester |