2-Furancarboxylic acid,5-(1,1-dimethylpropyl)-, methyl ester structure
|
Common Name | 2-Furancarboxylic acid,5-(1,1-dimethylpropyl)-, methyl ester | ||
|---|---|---|---|---|
| CAS Number | 91352-41-9 | Molecular Weight | 196.24300 | |
| Density | 1.015g/cm3 | Boiling Point | 262.2ºC at 760 mmHg | |
| Molecular Formula | C11H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 112.4ºC | |
| Name | methyl 5-(2-methylbutan-2-yl)furan-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.015g/cm3 |
|---|---|
| Boiling Point | 262.2ºC at 760 mmHg |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.24300 |
| Flash Point | 112.4ºC |
| Exact Mass | 196.11000 |
| PSA | 39.44000 |
| LogP | 2.75380 |
| Index of Refraction | 1.464 |
| InChIKey | YTAQQZFNQJRVGW-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)c1ccc(C(=O)OC)o1 |
|
~%
2-Furancarboxyl... CAS#:91352-41-9 |
| Literature: Gilman; Calloway Journal of the American Chemical Society, 1933 , vol. 55, p. 4197,4200 |
|
~%
2-Furancarboxyl... CAS#:91352-41-9 |
| Literature: Reichstein; Rosenberg; Eberhardt Helvetica Chimica Acta, 1935 , vol. 18, p. 721,724 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 5-tert-Pentyl-furan-2-carbonsaeure-methylester |
| 5-tert.-Amyl-brenzschleimsaeure-methylester |
| 5-tert-pentyl-furan-2-carboxylic acid methyl ester |