(3R,4S,6S)-2-(hydroxymethyl)-6-prop-2-ynoxyoxane-3,4,5-triol
(3R,4S,6S)-2-(hydroxymethyl)-6-prop-2-ynoxyoxane-3,4,5-triol structure
|
Common Name | (3R,4S,6S)-2-(hydroxymethyl)-6-prop-2-ynoxyoxane-3,4,5-triol | ||
|---|---|---|---|---|
| CAS Number | 913074-13-2 | Molecular Weight | 218.20400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H14O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: (3R,4S,6S)-2-(hydroxymethyl)-6-prop-2-ynoxyoxane-3,4,5-triol, also known as yndyl α-D-galactopyranoside, CAS 913074-13-2, molecular formula C9H14O6, molecular weight 218.20400. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (3R,4S,6S)-2-(hydroxymethyl)-6-prop-2-ynoxyoxane-3,4,5-triol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H14O6 |
|---|---|
| Molecular Weight | 218.20400 |
| Exact Mass | 218.07900 |
| PSA | 99.38000 |
| InChIKey | DSKUDOWHGLWCBQ-NXRLNHOXSA-N |
| SMILES | C#CCOC1OC(CO)C(O)C(O)C1O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Propargyl |A-D-Galactopyranoside |
| 2-Propynyl |A-D-Galactopyranoside |
| 2-Propyn-1-yl |A-D-Galactopyranoside |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of (3R,4S,6S)-2-(hydroxymethyl)-6-prop-2-ynoxyoxane-3,4,5-triol? |
| A: SMILES notation of (3R,4S,6S)-2-(hydroxymethyl)-6-prop-2-ynoxyoxane-3,4,5-triol is C#CCOC1OC(CO)C(O)C(O)C1O. |
| Q: What English synonyms does (3R,4S,6S)-2-(hydroxymethyl)-6-prop-2-ynoxyoxane-3,4,5-triol have? |
| A: English synonyms of (3R,4S,6S)-2-(hydroxymethyl)-6-prop-2-ynoxyoxane-3,4,5-triol: Propargyl |A-D-Galactopyranoside, 2-Propynyl |A-D-Galactopyranoside, 2-Propyn-1-yl |A-D-Galactopyranoside. |
| Q: What are the upstream materials of (3R,4S,6S)-2-(hydroxymethyl)-6-prop-2-ynoxyoxane-3,4,5-triol? |
| A: Related upstream materials(CAS) of (3R,4S,6S)-2-(hydroxymethyl)-6-prop-2-ynoxyoxane-3,4,5-triol: 10257-28-0;107-19-7;25878-60-8. |
| Q: What is the molecular weight of (3R,4S,6S)-2-(hydroxymethyl)-6-prop-2-ynoxyoxane-3,4,5-triol? |
| A: Molecular weight of (3R,4S,6S)-2-(hydroxymethyl)-6-prop-2-ynoxyoxane-3,4,5-triol is 218.20400. |
| Q: What is the molecular formula of (3R,4S,6S)-2-(hydroxymethyl)-6-prop-2-ynoxyoxane-3,4,5-triol? |
| A: Molecular formula of (3R,4S,6S)-2-(hydroxymethyl)-6-prop-2-ynoxyoxane-3,4,5-triol is C9H14O6. |
| Q: What is the English name of (3R,4S,6S)-2-(hydroxymethyl)-6-prop-2-ynoxyoxane-3,4,5-triol? |
| A: The English name of (3R,4S,6S)-2-(hydroxymethyl)-6-prop-2-ynoxyoxane-3,4,5-triol is (3R,4S,6S)-2-(hydroxymethyl)-6-prop-2-ynoxyoxane-3,4,5-triol. |
| Q: What is the InChIKey of (3R,4S,6S)-2-(hydroxymethyl)-6-prop-2-ynoxyoxane-3,4,5-triol? |
| A: InChIKey of (3R,4S,6S)-2-(hydroxymethyl)-6-prop-2-ynoxyoxane-3,4,5-triol is DSKUDOWHGLWCBQ-NXRLNHOXSA-N. |
| Q: What is the CAS number of (3R,4S,6S)-2-(hydroxymethyl)-6-prop-2-ynoxyoxane-3,4,5-triol? |
| A: CAS number of (3R,4S,6S)-2-(hydroxymethyl)-6-prop-2-ynoxyoxane-3,4,5-triol is 913074-13-2. |
| Q: What is the polar surface area (PSA) of (3R,4S,6S)-2-(hydroxymethyl)-6-prop-2-ynoxyoxane-3,4,5-triol? |
| A: Polar surface area (PSA) of (3R,4S,6S)-2-(hydroxymethyl)-6-prop-2-ynoxyoxane-3,4,5-triol is 99.38000. |