ML115
Modify Date: 2024-04-09 10:40:11
ML115 structure
|
Common Name | ML115 | ||
|---|---|---|---|---|
| CAS Number | 912798-42-6 | Molecular Weight | 322.74 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 422.9±45.0 °C at 760 mmHg | |
| Molecular Formula | C15H15ClN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.6±28.7 °C | |
Use of ML115ML115 is a molecular probe of the signal transducer and activator of transcription (STAT3). ML115 is a STAT3 agonist[1]. |
| Name | ML115 |
|---|---|
| Synonym | More Synonyms |
| Description | ML115 is a molecular probe of the signal transducer and activator of transcription (STAT3). ML115 is a STAT3 agonist[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 422.9±45.0 °C at 760 mmHg |
| Molecular Formula | C15H15ClN2O4 |
| Molecular Weight | 322.74 |
| Flash Point | 209.6±28.7 °C |
| Exact Mass | 322.072021 |
| LogP | 2.61 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.619 |
| InChIKey | FMWABCRYNLCXOJ-UHFFFAOYSA-N |
| SMILES | COc1cc(NC(=O)c2cc(C3CC3)on2)c(OC)cc1Cl |
| 3-Isoxazolecarboxamide, N-(4-chloro-2,5-dimethoxyphenyl)-5-cyclopropyl- |
| N-(4-chloro-2,5-dimethoxyphenyl)-5-cyclopropyl-3-isoxazolecarboxamide |
| ML115 |
| N-(4-Chloro-2,5-dimethoxyphenyl)-5-cyclopropyl-1,2-oxazole-3-carboxamide |