1-(2-FLUORO[1,1-BIPHENYL]-4-YL)ETHAN-1-ONE structure
|
Common Name | 1-(2-FLUORO[1,1-BIPHENYL]-4-YL)ETHAN-1-ONE | ||
|---|---|---|---|---|
| CAS Number | 912771-26-7 | Molecular Weight | 279.30700 | |
| Density | 1.25g/cm3 | Boiling Point | 474.1ºC at 760 mmHg | |
| Molecular Formula | C15H18FNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 240.5ºC | |
| Name | 1-[(2-fluorobenzoyl)amino]cycloheptane-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 474.1ºC at 760 mmHg |
| Molecular Formula | C15H18FNO3 |
| Molecular Weight | 279.30700 |
| Flash Point | 240.5ºC |
| Exact Mass | 279.12700 |
| PSA | 66.40000 |
| LogP | 3.12400 |
| Index of Refraction | 1.557 |
| InChIKey | JSHDIPURTAHREG-UHFFFAOYSA-N |
| SMILES | O=C(NC1(C(=O)O)CCCCCC1)c1ccccc1F |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-(2-Fluoro-benzoylamino)-cycloheptanecarboxylic acid |
| GL-0748 |