ethyl 2,3-diphenylpiperazine-1-carboxylate
Modify Date: 2025-10-13 09:29:57
ethyl 2,3-diphenylpiperazine-1-carboxylate structure
|
Common Name | ethyl 2,3-diphenylpiperazine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 912763-37-2 | Molecular Weight | 310.39000 | |
| Density | 1.124g/cm3 | Boiling Point | 443.3ºC at 760 mmHg | |
| Molecular Formula | C19H22N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.9ºC | |
| Name | ethyl 2,3-diphenylpiperazine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.124g/cm3 |
|---|---|
| Boiling Point | 443.3ºC at 760 mmHg |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.39000 |
| Flash Point | 221.9ºC |
| Exact Mass | 310.16800 |
| PSA | 41.57000 |
| LogP | 3.79740 |
| Index of Refraction | 1.564 |
| InChIKey | IHGUOBVQHSJQOW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N1CCNC(c2ccccc2)C1c1ccccc1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,3-diphenyl-piperazine-1-carboxylic acid ethyl ester |
| gl-0858 |