tert-butyl 4-(imidazol-1-ylmethyl)piperazine-1-carboxylate
Modify Date: 2025-09-10 20:18:59
tert-butyl 4-(imidazol-1-ylmethyl)piperazine-1-carboxylate structure
|
Common Name | tert-butyl 4-(imidazol-1-ylmethyl)piperazine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 912763-05-4 | Molecular Weight | 266.33900 | |
| Density | 1.16g/cm3 | Boiling Point | 407.5ºC at 760 mmHg | |
| Molecular Formula | C13H22N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.3ºC | |
| Name | tert-butyl 4-(imidazol-1-ylmethyl)piperazine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 407.5ºC at 760 mmHg |
| Molecular Formula | C13H22N4O2 |
| Molecular Weight | 266.33900 |
| Flash Point | 200.3ºC |
| Exact Mass | 266.17400 |
| PSA | 50.60000 |
| LogP | 1.26910 |
| Index of Refraction | 1.565 |
| InChIKey | SEUDYDVIMTUFTP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(Cn2ccnc2)CC1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| tert-butyl 4-(1H-imidazol-1-ylmethyl)piperazine-1-carboxylate |
| GL-0839 |