4-[4-(4-oxocyclohexylidene)cyclohexylidene]cyclohexan-1-one structure
|
Common Name | 4-[4-(4-oxocyclohexylidene)cyclohexylidene]cyclohexan-1-one | ||
|---|---|---|---|---|
| CAS Number | 91266-53-4 | Molecular Weight | 272.38200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H24O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[4-(4-oxocyclohexylidene)cyclohexylidene]cyclohexan-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H24O2 |
|---|---|
| Molecular Weight | 272.38200 |
| Exact Mass | 272.17800 |
| PSA | 34.14000 |
| LogP | 4.43980 |
| InChIKey | XFNHLNKERWRUNA-UHFFFAOYSA-N |
| SMILES | O=C1CCC(=C2CCC(=C3CCC(=O)CC3)CC2)CC1 |
|
~%
4-[4-(4-oxocycl... CAS#:91266-53-4 |
| Literature: McMurry, John E.; Haley, Gregory J.; Matz, James R.; Clardy, Jon C.; Duyne, Gregory Van Journal of the American Chemical Society, 1984 , vol. 106, # 17 p. 5018 - 5019 |
| Cyclohexanone,4,4'-(1,4-cyclohexanediylidene)bis |