[4-methyl-3-(2,2,2-trichloroethyl)phenyl] acetate structure
|
Common Name | [4-methyl-3-(2,2,2-trichloroethyl)phenyl] acetate | ||
|---|---|---|---|---|
| CAS Number | 91193-94-1 | Molecular Weight | 281.56300 | |
| Density | 1.338g/cm3 | Boiling Point | 323.7ºC at 760 mmHg | |
| Molecular Formula | C11H11Cl3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 124ºC | |
| Name | [4-methyl-3-(2,2,2-trichloroethyl)phenyl] acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.338g/cm3 |
|---|---|
| Boiling Point | 323.7ºC at 760 mmHg |
| Molecular Formula | C11H11Cl3O2 |
| Molecular Weight | 281.56300 |
| Flash Point | 124ºC |
| Exact Mass | 279.98200 |
| PSA | 26.30000 |
| LogP | 3.83300 |
| Index of Refraction | 1.544 |
| InChIKey | IYUIQDRIQANGPR-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1ccc(C)c(CC(Cl)(Cl)Cl)c1 |
|
~%
[4-methyl-3-(2,... CAS#:91193-94-1 |
| Literature: Newman,M.S.; Bayerlein,F. Journal of Organic Chemistry, 1963 , vol. 28, p. 2804 - 2806 |
| Precursor 2 | |
|---|---|
| DownStream 7 | |
| 4-methyl-3-(2,2,2-trichloroethyl)phenyl acetate |
| Essigsaeure-<4-methyl-3-(2.2.2-trichlor-ethyl)-phenyl>-ester |