9-chloro-2,3-dihydro-1H-chromeno[3,4-b][1,4]oxazin-5-one
Modify Date: 2025-08-25 14:51:06
![9-chloro-2,3-dihydro-1H-chromeno[3,4-b][1,4]oxazin-5-one Structure](https://image.chemsrc.com/caspic/068/91182-90-0.png)
9-chloro-2,3-dihydro-1H-chromeno[3,4-b][1,4]oxazin-5-one structure
|
Common Name | 9-chloro-2,3-dihydro-1H-chromeno[3,4-b][1,4]oxazin-5-one | ||
|---|---|---|---|---|
| CAS Number | 91182-90-0 | Molecular Weight | 237.63900 | |
| Density | 1.52g/cm3 | Boiling Point | 436.1ºC at 760 mmHg | |
| Molecular Formula | C11H8ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.5ºC | |
| Name | 9-chloro-2,3-dihydro-1H-chromeno[3,4-b][1,4]oxazin-5-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.52g/cm3 |
|---|---|
| Boiling Point | 436.1ºC at 760 mmHg |
| Molecular Formula | C11H8ClNO3 |
| Molecular Weight | 237.63900 |
| Flash Point | 217.5ºC |
| Exact Mass | 237.01900 |
| PSA | 51.47000 |
| LogP | 2.38870 |
| Index of Refraction | 1.657 |
| InChIKey | BJJIPLSVSQAUCB-UHFFFAOYSA-N |
| SMILES | O=c1oc2ccc(Cl)cc2c2c1OCCN2 |
|
~%
9-chloro-2,3-di... CAS#:91182-90-0 |
| Literature: Newman,M.S.; Perry,C.W. Journal of Organic Chemistry, 1963 , vol. 28, p. 116 - 120 |
|
~%
9-chloro-2,3-di... CAS#:91182-90-0 |
| Literature: Newman,M.S.; Dalton,C.K. Journal of Organic Chemistry, 1965 , vol. 30, p. 4122 - 4126 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 9-Chlor-2.3-dihydro<1>benzo-pyrano<3.4-b><1.4>oxazin-5(1H)-on |
| 9-Chlor-5-oxo-1.2.3.5-tetrahydro<1>benzopyrano<3.4-b><1.4>oxazin |