3-acetamido-4-methoxy-benzenesulfinic acid structure
|
Common Name | 3-acetamido-4-methoxy-benzenesulfinic acid | ||
|---|---|---|---|---|
| CAS Number | 91170-71-7 | Molecular Weight | 229.25300 | |
| Density | 1.45g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H11NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-acetamido-4-methoxybenzenesulfinic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.45g/cm3 |
|---|---|
| Molecular Formula | C9H11NO4S |
| Molecular Weight | 229.25300 |
| Exact Mass | 229.04100 |
| PSA | 94.84000 |
| LogP | 2.17290 |
| Index of Refraction | 1.635 |
| InChIKey | WOYZAIPHFPXHCP-UHFFFAOYSA-N |
| SMILES | COc1ccc(S(=O)O)cc1NC(C)=O |
|
~%
3-acetamido-4-m... CAS#:91170-71-7 |
| Literature: Child Journal of the Chemical Society, 1932 , p. 715,718 |
|
~%
3-acetamido-4-m... CAS#:91170-71-7 |
| Literature: Child Journal of the Chemical Society, 1932 , p. 715,718 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-Acetamino-4-methoxy-phenylsulfinsaeure |
| 3-Acetylamino-4-methoxy-benzolsulfinsaeure |