Benzene,1-chloro-2-[(phenylsulfonyl)methyl]- structure
|
Common Name | Benzene,1-chloro-2-[(phenylsulfonyl)methyl]- | ||
|---|---|---|---|---|
| CAS Number | 91110-67-7 | Molecular Weight | 266.74300 | |
| Density | 1.308g/cm3 | Boiling Point | 448.5ºC at 760mmHg | |
| Molecular Formula | C13H11ClO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225ºC | |
| Name | 1-(benzenesulfonylmethyl)-2-chlorobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.308g/cm3 |
|---|---|
| Boiling Point | 448.5ºC at 760mmHg |
| Molecular Formula | C13H11ClO2S |
| Molecular Weight | 266.74300 |
| Flash Point | 225ºC |
| Exact Mass | 266.01700 |
| PSA | 42.52000 |
| LogP | 4.39470 |
| Index of Refraction | 1.599 |
| InChIKey | LQMNONRWHSZGHE-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cc1ccccc1Cl)c1ccccc1 |
|
~%
Benzene,1-chlor... CAS#:91110-67-7 |
| Literature: Asthana; Misra Journal of the Indian Chemical Society, 1954 , vol. 31, p. 459 |
|
~%
Benzene,1-chlor... CAS#:91110-67-7 |
| Literature: Jumar; Schulze Journal fuer Praktische Chemie (Leipzig), 1958 , vol. <4> 5, p. 83,89 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-chloro-2-[(phenylsulfonyl)methyl]benzene |
| (2-chloro-benzyl)-phenyl sulfone |
| (2-Chlor-benzyl)-phenyl-sulfon |