Acetyl-(Cys4,D-Phe7,Cys10)-α-MSH (4-13) trifluoroacetate salt structure
|
Common Name | Acetyl-(Cys4,D-Phe7,Cys10)-α-MSH (4-13) trifluoroacetate salt | ||
|---|---|---|---|---|
| CAS Number | 91050-39-4 | Molecular Weight | 1343.578 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C61H86N18O13S2 | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Name | ac-cys-glu-his-d-phe-arg-trp-cys-lys-pro-val-nh2 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Molecular Formula | C61H86N18O13S2 |
| Molecular Weight | 1343.578 |
| Exact Mass | 1342.606323 |
| PSA | 545.59000 |
| LogP | -1.96 |
| Index of Refraction | 1.707 |
| InChIKey | YJLHIGSOJAOBEV-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1CSSCC(C(=O)NC(CCCCN)C(=O)N2CCCC2C(=O)NC(C(N)=O)C(C)C)NC(=O)C(Cc2c[nH]c3ccccc23)NC(=O)C(CCCN=C(N)N)NC(=O)C(Cc2ccccc2)NC(=O)C(Cc2cnc[nH]2)NC(=O)C(CCC(=O)O)NC1=O |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
Cyclic melanotropins. 9. 7-D-Phenylalanine analogues of the active-site sequence.
J. Med. Chem. 28 , 583, (1985) The cyclic melanotropin Ac-Ser1-Tyr2-Ser3-Cys4-Glu5-His6-Phe7-Arg8 -Trp9-Cys10-Lys11-Pro12-Val13-NH is a highly potent agonist as determined in several melanocyte bioassays. In linear melanotropins, a... |
| N-{[22-Acetamido-13-benzyl-10-(3-carbamimidamidopropyl)-19-(2-carboxyethyl)-16-(1H-imidazol-5-ylmethyl)-7-(1H-indol-3-ylmethyl)-6,9,12,15,18,21-hexaoxo-1,2-dithia-5,8,11,14,17,20-hexaazacyclotricos an-4-yl]carbonyl}lysylprolylvalinamide |
| Valinamide, N-[[22-(acetylamino)-10-[3-[[(E)-aminoiminomethyl]amino]propyl]-19-(2-carboxyethyl)-16-(1H-imidazol-5-ylmethyl)-7-(1H-indol-3-ylmethyl)-6,9,12,15,18,21-hexaoxo-13-(phenylmethyl)-1,2-dit 
hia-5,8,11,14,17,20-hexaazacyclotricos-4-yl]carbonyl]lysylprolyl- |
| Ac-CEHfRWCKPV-NH2 |