2-(aminomethyl)-3-[2-(trifluoromethoxy)phenyl]propanoic acid structure
|
Common Name | 2-(aminomethyl)-3-[2-(trifluoromethoxy)phenyl]propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 910443-92-4 | Molecular Weight | 263.21300 | |
| Density | 1.354g/cm3 | Boiling Point | 318.8ºC at 760 mmHg | |
| Molecular Formula | C11H12F3NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 146.6ºC | |
| Name | 2-(aminomethyl)-3-[2-(trifluoromethoxy)phenyl]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.354g/cm3 |
|---|---|
| Boiling Point | 318.8ºC at 760 mmHg |
| Molecular Formula | C11H12F3NO3 |
| Molecular Weight | 263.21300 |
| Flash Point | 146.6ºC |
| Exact Mass | 263.07700 |
| PSA | 72.55000 |
| LogP | 2.48750 |
| Index of Refraction | 1.501 |
| InChIKey | YCHQBHGFEJYTRV-UHFFFAOYSA-N |
| SMILES | NCC(Cc1ccccc1OC(F)(F)F)C(=O)O |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Aminomethyl-3-(2 |
| 3-AMINO-2-(2-(TRIFLUOROMETHOXY)BENZYL)PROPANOIC ACID |
| 3-amino-2-([2-(trifluoromethoxy)phenyl]methyl)propanoic acid |
| 2-Aminomethyl-3-(2-trifluoromethoxyphenyl)propionic acid |