N-Deshydroxyethyl Dasatinib structure
|
Common Name | N-Deshydroxyethyl Dasatinib | ||
|---|---|---|---|---|
| CAS Number | 910297-51-7 | Molecular Weight | 443.95300 | |
| Density | 1.404g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C20H22ClN7OS | Melting Point | >300ºC | |
| MSDS | N/A | Flash Point | N/A | |
Use of N-Deshydroxyethyl DasatinibTarget Protein-binding moiety 8 is a compound binding to BCR-ABL, and used for inhibiting BCR-ABL activity. |
| Name | N-(2-chloro-6-methylphenyl)-2-[(2-methyl-6-piperazin-1-ylpyrimidin-4-yl)amino]-1,3-thiazole-5-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Description | Target Protein-binding moiety 8 is a compound binding to BCR-ABL, and used for inhibiting BCR-ABL activity. |
|---|---|
| Related Catalog | |
| Target |
BCR-ABL[1] |
| In Vitro | Target Protein-binding moiety 8 (Compound 8) is a compound binding to BCR-ABL, and used for inhibiting BCR-ABL activity. |
| References |
| Density | 1.404g/cm3 |
|---|---|
| Melting Point | >300ºC |
| Molecular Formula | C20H22ClN7OS |
| Molecular Weight | 443.95300 |
| Exact Mass | 443.13000 |
| PSA | 123.31000 |
| LogP | 4.14860 |
| Index of Refraction | 1.69 |
| InChIKey | DOBZFFWLHXORTB-UHFFFAOYSA-N |
| SMILES | Cc1nc(Nc2ncc(C(=O)Nc3c(C)cccc3Cl)s2)cc(N2CCNCC2)n1 |
|
~20%
N-Deshydroxyeth... CAS#:910297-51-7 |
| Literature: Arora, Vinod Kumar; Christopher, Lisa Joy; Cui, Donghui; Li, Wenying Patent: US2006/211705 A1, 2006 ; Location in patent: Page/Page column 28 ; |
|
~79%
N-Deshydroxyeth... CAS#:910297-51-7 |
| Literature: Veach, Darren R.; Namavari, Mohammad; Pillarsetty, Nagavarakishore; Santos, Elmer B.; Beresten-Kochetkov, Tatiana; Lambek, Caryl; Punzalan, Blesida J.; Antczak, Christophe; Smith-Jones, Peter M.; Djaballah, Hakim; Clarkson, Bayard; Larson, Steven M. Journal of Medicinal Chemistry, 2007 , vol. 50, # 23 p. 5853 - 5857 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| N-(2-CHLORO-6-METHYLPHENYL)-2-[[2-METHYL-6-(PIPERAZIN-1-YL)-PYRIMIDIN-4-YL]AMINO]-5-THIAZOLECARBOXAMIDE |
| Dasatinib metabolite M4 |
| N-(2-chloro-6-methylphenyl)-2-(2-methyl-6-(piperazin-1-yl)pyrimidin-4-ylamino)thiazole-5-carboxamide |
| N-(2-chloro-6-methylphenyl)-2-[[2-methyl-6-(1-piperazinyl)-4-pyrimidinyl]amino]-5-thiazolecarboxamide |
| N-Deshydroxyethyl Dasatinib |
| Dasatinib Impurity 6 |
| Target Protein-binding moiety 8 |