Fmoc-6-chloro L-Tryptophan structure
|
Common Name | Fmoc-6-chloro L-Tryptophan | ||
|---|---|---|---|---|
| CAS Number | 908847-42-7 | Molecular Weight | 460.90900 | |
| Density | N/A | Boiling Point | 732.617°C at 760 mmHg | |
| Molecular Formula | C26H21ClN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 396.872°C | |
| Name | Fmoc-6-chloro-L-tryptophane |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 732.617°C at 760 mmHg |
|---|---|
| Molecular Formula | C26H21ClN2O4 |
| Molecular Weight | 460.90900 |
| Flash Point | 396.872°C |
| Exact Mass | 460.11900 |
| PSA | 91.42000 |
| LogP | 5.74660 |
| InChIKey | FDXGPPBWOOAVEL-DEOSSOPVSA-N |
| SMILES | O=C(NC(Cc1c[nH]c2cc(Cl)ccc12)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
|
~87%
Fmoc-6-chloro L... CAS#:908847-42-7 |
| Literature: Madden, Michael M.; Muppidi, Avinash; Li, Zhenyu; Li, Xiaolong; Chen, Jiandong; Lin, Qing Bioorganic and Medicinal Chemistry Letters, 2011 , vol. 21, # 5 p. 1472 - 1475 |
|
~87%
Fmoc-6-chloro L... CAS#:908847-42-7 |
| Literature: Harker, Elizabeth A.; Daniels, Douglas S.; Guarracino, Danielle A.; Schepartz, Alanna Bioorganic and Medicinal Chemistry, 2009 , vol. 17, # 5 p. 2038 - 2046 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Fmoc-6-chloro L-Tryptophan |
| (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(6-chloro-1H-indol-3-yl)propanoic acid |
| Fmoc-6-chloro-L-tryptophan |