(±)10-HDoHE
Modify Date: 2025-08-26 10:44:52
(±)10-HDoHE structure
|
Common Name | (±)10-HDoHE | ||
|---|---|---|---|---|
| CAS Number | 90780-50-0 | Molecular Weight | 344.488 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 511.2±50.0 °C at 760 mmHg | |
| Molecular Formula | C22H32O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 277.1±26.6 °C | |
Use of (±)10-HDoHE(±)10-HDHA is a potential marker of oxidative stress in brain and retina where DHA is an abundant polyunsaturated fatty acid. |
| Name | 10-hydroxydocosa-4,7,11,13,16,19-hexaenoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 511.2±50.0 °C at 760 mmHg |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.488 |
| Flash Point | 277.1±26.6 °C |
| Exact Mass | 344.235138 |
| PSA | 57.53000 |
| LogP | 5.48 |
| Vapour Pressure | 0.0±3.0 mmHg at 25°C |
| Index of Refraction | 1.533 |
| InChIKey | DDCYKEYDTGCKAS-SIPWHZQYSA-N |
| SMILES | CCC=CCC=CCC=CC=CC(O)CC=CCC=CCCC(=O)O |
| 4,7,11,13,16,19-Docosahexaenoic acid, 10-hydroxy-, (4Z,7Z,11E,13Z,16Z,19Z)- |
| (4Z,7Z,11E,13Z,16Z,19Z)-10-Hydroxy-4,7,11,13,16,19-docosahexaenoic acid |