3-chloro-5-(trichloromethyl)-2,3,4,5,6,7-hexahydro-1H-tricyclo[2.2.1.02,6]heptane
Modify Date: 2025-11-25 15:44:53
![3-chloro-5-(trichloromethyl)-2,3,4,5,6,7-hexahydro-1H-tricyclo[2.2.1.02,6]heptane Structure](https://image.chemsrc.com/caspic/294/90638-71-4.png)
3-chloro-5-(trichloromethyl)-2,3,4,5,6,7-hexahydro-1H-tricyclo[2.2.1.02,6]heptane structure
|
Common Name | 3-chloro-5-(trichloromethyl)-2,3,4,5,6,7-hexahydro-1H-tricyclo[2.2.1.02,6]heptane | ||
|---|---|---|---|---|
| CAS Number | 90638-71-4 | Molecular Weight | 245.96100 | |
| Density | 1.58g/cm3 | Boiling Point | 293.1ºC at 760 mmHg | |
| Molecular Formula | C8H8Cl4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136ºC | |
| Name | 3-chloro-5-(trichloromethyl)-2,3,4,5,6,7-hexahydro-1H-tricyclo[2.2.1.02,6]heptane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.58g/cm3 |
|---|---|
| Boiling Point | 293.1ºC at 760 mmHg |
| Molecular Formula | C8H8Cl4 |
| Molecular Weight | 245.96100 |
| Flash Point | 136ºC |
| Exact Mass | 243.93800 |
| LogP | 3.47590 |
| Index of Refraction | 1.587 |
| InChIKey | DJDUWCZIXKFKKF-UHFFFAOYSA-N |
| SMILES | ClC1C2CC3C1C3C2C(Cl)(Cl)Cl |
|
~%
3-chloro-5-(tri... CAS#:90638-71-4 |
| Literature: Elzinga,J.; Hogeveen,H. Journal of the Chemical Society, Chemical Communications, 1977 , p. 705 - 706 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-chloro-5-(trichloromethyl)tricyclo[2.2.1.02,6]heptane |
| 3-Trichlormethyl-5-chlor-nortricyclen |