9-Methyl-9H-carbazole-3-sulfonyl chloride
Modify Date: 2025-08-25 11:03:29
9-Methyl-9H-carbazole-3-sulfonyl chloride structure
|
Common Name | 9-Methyl-9H-carbazole-3-sulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 905978-77-0 | Molecular Weight | 279.74200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10ClNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 9-Methyl-9H-carbazole-3-sulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H10ClNO2S |
|---|---|
| Molecular Weight | 279.74200 |
| Exact Mass | 279.01200 |
| PSA | 47.45000 |
| LogP | 4.33980 |
| InChIKey | HUGGWTFEJQFFBF-UHFFFAOYSA-N |
| SMILES | Cn1c2ccccc2c2cc(S(=O)(=O)Cl)ccc21 |
|
~62%
9-Methyl-9H-car... CAS#:905978-77-0 |
| Literature: Hu, Laixing; Li, Zhuo-rong; Wang, Yue-ming; Wu, Yanbin; Jiang, Jian-Dong; Boykin, David W. Bioorganic and Medicinal Chemistry Letters, 2007 , vol. 17, # 5 p. 1193 - 1196 |
|
~%
9-Methyl-9H-car... CAS#:905978-77-0 |
| Literature: Hu, Laixing; Li, Zhuo-rong; Wang, Yue-ming; Wu, Yanbin; Jiang, Jian-Dong; Boykin, David W. Bioorganic and Medicinal Chemistry Letters, 2007 , vol. 17, # 5 p. 1193 - 1196 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 9-methylcarbazole-3-sulfonyl chloride |