N-(2-aminoethyl)-4-methoxybenzenesulfonamide
Modify Date: 2025-08-28 18:30:58
N-(2-aminoethyl)-4-methoxybenzenesulfonamide structure
|
Common Name | N-(2-aminoethyl)-4-methoxybenzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 90566-22-6 | Molecular Weight | 230.28400 | |
| Density | 1.25g/cm3 | Boiling Point | 389ºC at 760 mmHg | |
| Molecular Formula | C9H14N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189ºC | |
| Name | N-(2-aminoethyl)-4-methoxybenzenesulfonamide |
|---|
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 389ºC at 760 mmHg |
| Molecular Formula | C9H14N2O3S |
| Molecular Weight | 230.28400 |
| Flash Point | 189ºC |
| Exact Mass | 230.07300 |
| PSA | 89.80000 |
| LogP | 2.10420 |
| Index of Refraction | 1.547 |
| InChIKey | DXJTYJVSEICHGS-UHFFFAOYSA-N |
| SMILES | COc1ccc(S(=O)(=O)NCCN)cc1 |
|
~%
N-(2-aminoethyl... CAS#:90566-22-6 |
| Literature: Um, Ik-Hwan; Hong, Jin-Young; Seok, Jin-Ah Journal of Organic Chemistry, 2005 , vol. 70, # 4 p. 1438 - 1444 |
|
~%
N-(2-aminoethyl... CAS#:90566-22-6 |
| Literature: Um, Ik-Hwan; Hong, Jin-Young; Seok, Jin-Ah Journal of Organic Chemistry, 2005 , vol. 70, # 4 p. 1438 - 1444 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |