4,6(1H,5H)-Pyrimidinedione,dihydro-5-(3-methylbutyl)-2-thioxo- structure
|
Common Name | 4,6(1H,5H)-Pyrimidinedione,dihydro-5-(3-methylbutyl)-2-thioxo- | ||
|---|---|---|---|---|
| CAS Number | 90565-96-1 | Molecular Weight | 214.28500 | |
| Density | 1.22g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H14N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(3-methylbutyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.28500 |
| Exact Mass | 214.07800 |
| PSA | 90.29000 |
| LogP | 1.22730 |
| Index of Refraction | 1.556 |
| InChIKey | STSXPMBDBFYHQC-UHFFFAOYSA-N |
| SMILES | CC(C)CCC1C(=O)NC(=S)NC1=O |
|
~64%
4,6(1H,5H)-Pyri... CAS#:90565-96-1 |
| Literature: Yebga, A.; Menager, S.; Verite, P.; Farnoux, C. Combet; Lafont, O. European Journal of Medicinal Chemistry, 1995 , vol. 30, # 10 p. 769 - 778 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 5-(3-methylbutyl)-2-thiobarbituric acid |
| 5-Isopentyl-2-thio-barbitursaeure |
| 5-isopentyl-2-thio-barbituric acid |