ethyl 7-amino-2-(methylthio)[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate structure
|
Common Name | ethyl 7-amino-2-(methylthio)[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 90559-98-1 | Molecular Weight | 253.28100 | |
| Density | 1.59g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H11N5O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 7-amino-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.59g/cm3 |
|---|---|
| Molecular Formula | C9H11N5O2S |
| Molecular Weight | 253.28100 |
| Exact Mass | 253.06300 |
| PSA | 120.70000 |
| LogP | 1.18630 |
| Index of Refraction | 1.733 |
| InChIKey | GULODKWZYHQFFL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cnc2nc(SC)nn2c1N |
| HS Code | 2933990090 |
|---|
|
~68%
ethyl 7-amino-2... CAS#:90559-98-1 |
| Literature: Reiter; Pongo; Dvortsak Journal of Heterocyclic Chemistry, 1987 , vol. 24, # 4 p. 1149 - 1154 |
|
~60%
ethyl 7-amino-2... CAS#:90559-98-1 |
| Literature: Reiter; Pongo; Dvortsak Journal of Heterocyclic Chemistry, 1987 , vol. 24, # 4 p. 1149 - 1154 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Amino-6-ethoxycarbonyl-2-methylthio-1,2,4-triazolo<1,5-a>pyrimidine |
| HMS2594J10 |
| HMS546J13 |
| 7-Amino-2-methylmercapto-6-aethoxycarbonyl-s-triazolo<1.5-a>pyrimidin |