anthracen-9-yl-dimethyl-trimethylsilylsilane
Modify Date: 2025-09-25 04:15:34
anthracen-9-yl-dimethyl-trimethylsilylsilane structure
|
Common Name | anthracen-9-yl-dimethyl-trimethylsilylsilane | ||
|---|---|---|---|---|
| CAS Number | 90522-22-8 | Molecular Weight | 308.56500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H24Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | anthracen-9-yl-dimethyl-trimethylsilylsilane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H24Si2 |
|---|---|
| Molecular Weight | 308.56500 |
| Exact Mass | 308.14200 |
| LogP | 5.32500 |
| InChIKey | FHUHBAOZQYFCRI-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)[Si](C)(C)c1c2ccccc2cc2ccccc12 |
|
~48%
anthracen-9-yl-... CAS#:90522-22-8 |
| Literature: Shizuka, Haruo; Sato, Yoshihiro; Ueki, Yutaka; Ishikawa, Mitsuo; Kumada, Makoto Journal of the Chemical Society, Faraday Transactions 1: Physical Chemistry in Condensed Phases, 1984 , vol. 80, p. 341 - 358 |
| 9-(pentamethyldisilanyl)anthracene |
| 9-(pentamethyldisylanyl)anthracene |
| Disilane,9-anthracenylpentamethyl |
| 9-anthrylpentamethyldisilane |
| 9-pentamethyl-disilylanthracene |