2-(4-chlorophenyl)-1,3-diazaspiro[4.4]non-1-en-4-one
Modify Date: 2025-11-29 07:43:27
![2-(4-chlorophenyl)-1,3-diazaspiro[4.4]non-1-en-4-one Structure](https://image.chemsrc.com/caspic/436/904816-22-4.png)
2-(4-chlorophenyl)-1,3-diazaspiro[4.4]non-1-en-4-one structure
|
Common Name | 2-(4-chlorophenyl)-1,3-diazaspiro[4.4]non-1-en-4-one | ||
|---|---|---|---|---|
| CAS Number | 904816-22-4 | Molecular Weight | 248.70800 | |
| Density | 1.39g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H13ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-chlorophenyl)-1,3-diazaspiro[4.4]non-1-en-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Molecular Formula | C13H13ClN2O |
| Molecular Weight | 248.70800 |
| Exact Mass | 248.07200 |
| PSA | 41.46000 |
| LogP | 2.29360 |
| Index of Refraction | 1.676 |
| InChIKey | ZXDSRULQZPFUDN-UHFFFAOYSA-N |
| SMILES | O=C1NC(c2ccc(Cl)cc2)=NC12CCCC2 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(4-Chloro-phenyl)-1,3-diaza-spiro[4.4]non-1-en-4-one |
| GL-0517 |